169760-16-1 Usage
Description
2-Acetamidophenylboronic acid is an organic compound with the chemical formula C6H9NO3B. It is a white to brown solid and may contain varying amounts of anhydride. 2-Acetamidophenylboronic acid is known for its versatile chemical properties and is utilized in the synthesis of various complex organic molecules, particularly in the pharmaceutical and chemical industries.
Uses
Used in Pharmaceutical Industry:
2-Acetamidophenylboronic acid is used as a key reactant for the preparation of a wide range of biologically active compounds, which are essential in the development of new drugs and therapeutic agents. Its applications include:
1. Highly substituted acenes: These are synthesized via rhodium-catalyzed oxidative coupling with alkynes, which are important for the development of advanced materials with potential applications in organic electronics and photovoltaics.
2. Anticancer pyrimidines: 2-Acetamidophenylboronic acid is used in the synthesis of pyrimidines with multiple-kinase inhibitory effects, which are crucial in the development of targeted cancer therapies.
3. 3,4-ring fused 7-azaindoles and deazapurines: These compounds are potent JAK2 inhibitors, which play a significant role in the treatment of various cancers and inflammatory diseases.
4. Polycyclic azaindoles: These are synthesized as JAK2 inhibitors, which are essential in the development of targeted therapies for cancer and autoimmune disorders.
5. ROS1 receptor tyrosine kinase inhibitors: 2-Acetamidophenylboronic acid is used in the synthesis of inhibitors targeting the ROS1 receptor tyrosine kinase, which is overexpressed in certain types of cancers and is a potential therapeutic target.
6. 2-aminopyrazolopyridines: These compounds are synthesized as Polo-like kinase 1 (PLK1) inhibitors, which are important in the development of anticancer drugs targeting cell division and proliferation.
Check Digit Verification of cas no
The CAS Registry Mumber 169760-16-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,6,9,7,6 and 0 respectively; the second part has 2 digits, 1 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 169760-16:
(8*1)+(7*6)+(6*9)+(5*7)+(4*6)+(3*0)+(2*1)+(1*6)=171
171 % 10 = 1
So 169760-16-1 is a valid CAS Registry Number.
InChI:InChI=1/C8H10BNO3/c1-6(11)10-8-5-3-2-4-7(8)9(12)13/h2-5,12-13H,1H3,(H,10,11)
169760-16-1Relevant articles and documents
Fused heterotricyclic compounds as inhibitors of 17beta-hydroxysteroid dehydrogenase 3
-
Page/Page column 47, (2008/06/13)
Fused heterotricyclic compounds, methods of using such compounds in the treatment of hormone sensitive diseases such as prostate cancer, and pharmaceutical compositions containing such compounds.