15844-92-5 Usage
General Description
Zirconium stearate is a chemical compound that is used as a homogeneous catalyst and a crosslinking agent in various industrial applications, such as in the production of textiles, plastics, and rubber. It is commonly employed in the manufacturing of adhesives, coatings, and paints, where it serves as a stabilizer and hardener. Zirconium stearate also finds use as an emulsifier and dispersing agent in the production of cosmetics and personal care products. Additionally, this chemical is known for its high thermal stability and corrosion resistance, making it a valuable additive in the formulation of high-temperature lubricants and greases for automotive and aerospace applications. Overall, zirconium stearate plays a crucial role in improving the performance and durability of a wide range of products across different industries.
Check Digit Verification of cas no
The CAS Registry Mumber 15844-92-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,5,8,4 and 4 respectively; the second part has 2 digits, 9 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 15844-92:
(7*1)+(6*5)+(5*8)+(4*4)+(3*4)+(2*9)+(1*2)=125
125 % 10 = 5
So 15844-92-5 is a valid CAS Registry Number.
InChI:InChI=1/C18H36O2.Zr/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;/h2-17H2,1H3,(H,19,20);/p-1
