156499-64-8 Usage
Uses
Used in Pharmaceutical Industry:
2,3-difluoro-1-iodo-4-methoxybenzene is used as a key intermediate in the production of various pharmaceutical ingredients. Its unique structure and reactivity make it a valuable component in the synthesis of organic compounds used in the development of new drugs.
Used in Agrochemical Industry:
In the agrochemical industry, 2,3-difluoro-1-iodo-4-methoxybenzene serves as an essential intermediate for the synthesis of various agrochemicals, contributing to the development of new pesticides and other agricultural chemicals.
Used in Research and Development:
2,3-difluoro-1-iodo-4-methoxybenzene is utilized in the research and development of new materials and chemicals due to its unique properties and reactivity. Its potential applications in this field are vast, as it can be used to explore and create innovative compounds for various industries.
Safety Precautions:
It is important to handle 2,3-difluoro-1-iodo-4-methoxybenzene with care, as it can be harmful if ingested, inhaled, or in contact with skin and eyes. Proper safety measures should be taken during its use to minimize potential risks.
Check Digit Verification of cas no
The CAS Registry Mumber 156499-64-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,5,6,4,9 and 9 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 156499-64:
(8*1)+(7*5)+(6*6)+(5*4)+(4*9)+(3*9)+(2*6)+(1*4)=178
178 % 10 = 8
So 156499-64-8 is a valid CAS Registry Number.
InChI:InChI=1/C7H5F2IO/c1-11-5-3-2-4(10)6(8)7(5)9/h2-3H,1H3
