149676-40-4 Usage
Description
1-Ethyl-6-fluoro-7-(4-methylpiperazin-1-yl)-4-oxo-quinoline-3-carboxylic acid is a complex organic compound with a quinoline-based structure. It is characterized by its white powder form and possesses unique chemical properties that make it suitable for various applications in different industries.
Uses
Used in Pharmaceutical Industry:
1-Ethyl-6-fluoro-7-(4-methylpiperazin-1-yl)-4-oxo-quinoline-3-carboxylic acid is used as an antifungal agent for treating various fungal infections. Its chemical structure allows it to effectively target and inhibit the growth of fungi, making it a valuable component in the development of antifungal medications.
1-Ethyl-6-fluoro-7-(4-methylpiperazin-1-yl)-4-oxo-quinoline-3-carboxylic acid is also used as a calmodulin antagonist in the pharmaceutical industry. Calmodulin is a calcium-binding protein involved in various cellular processes, and its inhibition can have therapeutic effects in certain conditions.
Used in Antimicrobial Applications:
In the field of antimicrobial research, 1-Ethyl-6-fluoro-7-(4-methylpiperazin-1-yl)-4-oxo-quinoline-3-carboxylic acid is used as an analog of norfloxacin, which is known to inhibit topoisomerase. This property makes it a potential candidate for the development of new antimicrobial drugs to combat bacterial infections.
Used in Chemical Research:
Due to its unique chemical properties and structure, 1-Ethyl-6-fluoro-7-(4-methylpiperazin-1-yl)-4-oxo-quinoline-3-carboxylic acid can be utilized in chemical research for the synthesis of various compounds and the study of their properties and potential applications in different fields.
Check Digit Verification of cas no
The CAS Registry Mumber 149676-40-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,9,6,7 and 6 respectively; the second part has 2 digits, 4 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 149676-40:
(8*1)+(7*4)+(6*9)+(5*6)+(4*7)+(3*6)+(2*4)+(1*0)=174
174 % 10 = 4
So 149676-40-4 is a valid CAS Registry Number.
InChI:InChI=1/C17H20FN3O3/c1-3-20-10-12(17(23)24)16(22)11-8-13(18)15(9-14(11)20)21-6-4-19(2)5-7-21/h8-10H,3-7H2,1-2H3,(H,23,24)