14208-99-2 Usage
Description
1-(2-(2-Hydroxyethylamino)ethyl)adamantane hydrochloride is a hydrochloride salt of an adamantane derivative, featuring a hydroxyethylamino group that may contribute to its pharmacological activity. This chemical compound is characterized by its potential pharmaceutical uses, possibly in the treatment of neurological or psychiatric disorders, due to its structural similarity to known psychoactive compounds and its ability to interact with biological systems.
Uses
Used in Pharmaceutical Industry:
1-(2-(2-Hydroxyethylamino)ethyl)adamantane hydrochloride is used as a potential drug candidate for the treatment of neurological or psychiatric disorders. Its structural similarity to known psychoactive compounds and its ability to interact with biological systems make it a promising candidate for further research and development in this field.
Further research is needed to fully understand the properties and potential applications of 1-(2-(2-Hydroxyethylamino)ethyl)adamantane hydrochloride, including its pharmacological activity, safety, and efficacy in treating specific disorders.
Check Digit Verification of cas no
The CAS Registry Mumber 14208-99-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,4,2,0 and 8 respectively; the second part has 2 digits, 9 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 14208-99:
(7*1)+(6*4)+(5*2)+(4*0)+(3*8)+(2*9)+(1*9)=92
92 % 10 = 2
So 14208-99-2 is a valid CAS Registry Number.
InChI:InChI=1/C14H25NO.ClH/c16-4-3-15-2-1-14-8-11-5-12(9-14)7-13(6-11)10-14;/h11-13,15-16H,1-10H2;1H
