123088-59-5 Usage
Description
4-Carbamoylphenylboronic acid is an organic compound that serves as a versatile reactant in various chemical reactions, particularly in the field of organic synthesis. It is a white to brown solid and is known for its involvement in cross-coupling reactions, which are essential for the creation of complex molecular structures.
Uses
1. Used in Organic Synthesis:
4-Carbamoylphenylboronic acid is used as a reactant for the synthesis of substituted pyrene derivatives through Suzuki-Miyaura, Sonogashira, and Buchwald-Hartwig cross-coupling reactions. These reactions are crucial for the development of novel chemical compounds with potential applications in various industries.
2. Used in Pharmaceutical Industry:
In the pharmaceutical industry, 4-Carbamoylphenylboronic acid is used as a reactant for the synthesis of biologically active molecules. These molecules include hybrid peptidomimetic molecules that act as STAT3 protein inhibitors, vasopressin V1B receptor antagonists for use as antidepressants and anxiolytics, and (thienopyridine)carboxamides that serve as CHK1 inhibitors.
3. Used in Suzuki-Miyaura Reactions:
4-Carbamoylphenylboronic acid is also utilized in Suzuki-Miyaura reactions for the synthesis of aryl-substituted oxabenzindoles and methanobenzindoles or 2-aminoimidazole triazoles. These compounds have potential applications in the development of new drugs and therapeutic agents.
4. Used in Three-component Coupling:
4-Carbamoylphenylboronic acid is used as a reactant in three-component coupling with triflates and alkenes. This reaction is an important synthetic strategy for constructing complex molecular structures with potential applications in various fields, including pharmaceuticals, materials science, and agrochemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 123088-59-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,3,0,8 and 8 respectively; the second part has 2 digits, 5 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 123088-59:
(8*1)+(7*2)+(6*3)+(5*0)+(4*8)+(3*8)+(2*5)+(1*9)=115
115 % 10 = 5
So 123088-59-5 is a valid CAS Registry Number.
InChI:InChI=1/C7H8BNO3/c9-7(10)5-1-3-6(4-2-5)8(11)12/h1-4,11-12H,(H2,9,10)
123088-59-5Relevant articles and documents
AMINOPYRAZINE DERIVATIVE AND MEDICINE
-
Page/Page column 40, (2011/12/12)
The present invention relates to a compound represented by general formula [1] satisfying the following (I) or (II), or a pharmaceutical acceptable salt of the compound. (I) X is CH or N; R1 is a halogen atom,; and R2 is H, a halogen atom, CN, [2], [3], [8], [9], an —O-alkyl, an —O-(saturated ring), etc. [2]: —C(RC)(RD)(RE) (RC to RE each are H, an alkyl, etc.) [3]: —N(RF)(RG) (RF and RG each are H, OH, amino, a (hetero)aryl, etc.) [8]: —C(═O)RL (RL is an alkyl, OH, an alkoxy, amino, etc.) [9]: a (substituted)phenyl; (II) X is >C—C(—O)R3 (R3 is a (substituted)amino, an alkoxy, OH, etc.); R1 is a halogen atom; R2 is H; R3 is H or OH; and R3 and R4 each are H or an alkyl.
Substituted phenyl derivatives, their preparation and use
-
, (2008/06/13)
The present invention discloses compounds having the formula wherein the substituents are defined in the application. The compounds are useful as chloride channel blockers.
Substituted phenyl derivatives, their preparation and use
-
, (2008/06/13)
The present invention discloses compounds having the formula wherein the substituents are defined in the application. The compounds are useful as chloride channel blockers.
