1204298-70-3 Usage
Description
5-(difluoromethyl)-1-methyl-1H-pyrazole-4-carbaldehyde is a chemical compound characterized by its molecular formula C6H5F2N3O. It is a pyrazole derivative that features a difluoromethyl group, a methyl group, and an aldehyde functional group within its structure. This versatile compound holds potential in various fields, particularly in organic synthesis and pharmaceutical industries, where it may serve as a building block for the development of pharmaceuticals and agrochemicals. Its potential bioactive properties also make it a candidate of interest for medicinal chemistry research.
Uses
Used in Organic Synthesis:
5-(difluoromethyl)-1-methyl-1H-pyrazole-4-carbaldehyde is used as a key intermediate in organic synthesis for the creation of various complex organic molecules. Its unique structure allows for the formation of diverse chemical entities, contributing to the advancement of chemical research and development.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 5-(difluoromethyl)-1-methyl-1H-pyrazole-4-carbaldehyde is utilized as a building block for the synthesis of pharmaceuticals. Its incorporation into drug molecules can potentially enhance their therapeutic properties, such as improving pharmacokinetics, potency, or selectivity.
Used in Agrochemicals:
5-(difluoromethyl)-1-methyl-1H-pyrazole-4-carbaldehyde is also used in the development of agrochemicals, where it may contribute to the creation of novel pesticides or other agricultural chemicals. Its potential to be incorporated into these compounds can lead to more effective and targeted pest control solutions.
Used in Medicinal Chemistry Research:
Due to its potential bioactive properties, 5-(difluoromethyl)-1-methyl-1H-pyrazole-4-carbaldehyde is employed in medicinal chemistry research. Scientists explore its interactions with biological targets to identify new therapeutic opportunities and understand its mechanisms of action, which could lead to the discovery of new drugs or drug candidates.
Check Digit Verification of cas no
The CAS Registry Mumber 1204298-70-3 includes 10 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 7 digits, 1,2,0,4,2,9 and 8 respectively; the second part has 2 digits, 7 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 1204298-70:
(9*1)+(8*2)+(7*0)+(6*4)+(5*2)+(4*9)+(3*8)+(2*7)+(1*0)=133
133 % 10 = 3
So 1204298-70-3 is a valid CAS Registry Number.
InChI:InChI=1S/C6H6F2N2O/c1-10-5(6(7)8)4(3-11)2-9-10/h2-3,6H,1H3
