1043-21-6 Usage
Description
Pirenoxine, also known as Piridostigmine, is a synthetic derivative of the naturally occurring alkaloid physostigmine. It is a reversible acetylcholinesterase inhibitor, which means it can temporarily increase the concentration of acetylcholine in the synaptic cleft by inhibiting its breakdown. This action leads to enhanced cholinergic transmission, making Pirenoxine a promising candidate for various medical applications.
Source:
Pirenoxine is a synthetic compound, and its production involves chemical synthesis processes.
Production Methods:
Pirenoxine is synthesized through a series of chemical reactions starting from the precursor compound, physostigmine. The synthesis process involves several steps, including protection and deprotection of functional groups, formation of the quaternary ammonium group, and purification.
Uses
Used in Ophthalmology:
Pirenoxine is used as an anti-cataract agent for the possible treatment and prevention of cataracts. It is believed to protect the lens of the eye from oxidative damage and maintain its transparency by inhibiting the formation of advanced glycation end products (AGEs) and reducing oxidative stress.
Used in Neurology:
Pirenoxine is used as a medication for the symptomatic treatment of myasthenia gravis, a neuromuscular disorder characterized by muscle weakness and fatigue. It works by increasing the concentration of acetylcholine in the synaptic cleft, thereby enhancing neuromuscular transmission and improving muscle strength.
Used in Antiviral Applications:
Pirenoxine has been found to possess antiviral properties, making it a potential candidate for the treatment and prevention of viral infections. Its antiviral activity is thought to be due to its ability to inhibit viral replication and reduce viral load in infected cells.
Check Digit Verification of cas no
The CAS Registry Mumber 1043-21-6 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,0,4 and 3 respectively; the second part has 2 digits, 2 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 1043-21:
(6*1)+(5*0)+(4*4)+(3*3)+(2*2)+(1*1)=36
36 % 10 = 6
So 1043-21-6 is a valid CAS Registry Number.
InChI:InChI=1/C16H8N2O5/c19-9-5-8(16(21)22)18-14-10(20)6-12-15(13(9)14)17-7-3-1-2-4-11(7)23-12/h1-6H,(H,18,19)(H,21,22)