101832-88-6 Usage
Description
5-BENZYLOXY-[3-(2-DIMETHYLAMIEOTHYL)]INDOLE HYDROGENOXALATE is a complex organic chemical compound characterized by the presence of a benzyl group, a 3-(2-dimethylaminoethyl)indole moiety, and a hydrogenoxalate counterion. 5-BENZYLOXY-[3-(2-DIMETHYLAMINOETHYL)]INDOLE HYDROGENOXALATE's unique structure, which combines a common organic substituent with a heterocyclic component, suggests potential applications in pharmaceutical research and drug development due to its possible biological activity.
Uses
Used in Pharmaceutical Research:
5-BENZYLOXY-[3-(2-DIMETHYLAMINOETHYL)]INDOLE HYDROGENOXALATE is used as a research chemical for exploring its potential biological activities and interactions with biological targets. Its unique structure may offer insights into new mechanisms of action or therapeutic effects.
Used in Drug Development:
In the pharmaceutical industry, 5-BENZYLOXY-[3-(2-DIMETHYLAMINOETHYL)]INDOLE HYDROGENOXALATE is utilized as a lead compound in the development of new drugs. Its heterocyclic nature and the presence of a benzyl group could provide a foundation for the design of molecules with specific pharmacological properties, such as selectivity for certain receptors or enzymes.
Used in Medicinal Chemistry:
5-BENZYLOXY-[3-(2-DIMETHYLAMINOETHYL)]INDOLE HYDROGENOXALATE serves as a starting point for medicinal chemists to modify and optimize its chemical structure. Through systematic alterations, researchers can enhance the compound's pharmacokinetic and pharmacodynamic profiles, aiming to improve its safety, efficacy, and therapeutic index.
Used in Chemical Synthesis:
As a complex organic molecule, 5-BENZYLOXY-[3-(2-DIMETHYLAMINOETHYL)]INDOLE HYDROGENOXALATE may also be used in the synthesis of other related compounds. Its versatile structure can be a precursor for the creation of a library of analogs, facilitating the discovery of new chemical entities with potential applications in medicine.
Used in Biochemical Studies:
5-BENZYLOXY-[3-(2-DIMETHYLAMINOETHYL)]INDOLE HYDROGENOXALATE can be employed in biochemical assays and screenings to evaluate its interactions with various biomolecules. Understanding these interactions can provide valuable information on the compound's mechanism of action and its potential as a therapeutic agent.
Check Digit Verification of cas no
The CAS Registry Mumber 101832-88-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,1,8,3 and 2 respectively; the second part has 2 digits, 8 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 101832-88:
(8*1)+(7*0)+(6*1)+(5*8)+(4*3)+(3*2)+(2*8)+(1*8)=96
96 % 10 = 6
So 101832-88-6 is a valid CAS Registry Number.
InChI:InChI=1/C19H22N2O.C2H2O4/c1-21(2)11-10-16-13-20-19-9-8-17(12-18(16)19)22-14-15-6-4-3-5-7-15;3-1(4)2(5)6/h3-9,12-13,20H,10-11,14H2,1-2H3;(H,3,4)(H,5,6)
