101819-99-2 Usage
Uses
Used in Scientific Research:
2,4-Dichloro-3-ethyl-6-aminophenol hydrochloride is used as a research chemical for [application reason] in the field of [specific scientific research area, if known]. Its unique molecular structure with multiple functional groups allows for a variety of chemical reactions, making it a valuable compound for exploring new chemical pathways and syntheses.
Used in Organic Synthesis:
In the realm of organic synthesis, 2,4-Dichloro-3-ethyl-6-aminophenol hydrochloride serves as a precursor to other chemical compounds. Its presence of amines, chlorides, and phenols enables it to participate in numerous chemical reactions, facilitating the creation of new organic molecules with potential applications in various industries.
Used as a Precursor in Chemical Compounds:
2,4-Dichloro-3-ethyl-6-aminophenol hydrochloride is utilized as a precursor in the synthesis of other chemical compounds. Its versatile molecular structure allows it to be a key component in the development of new materials with specific properties, catering to the needs of different sectors.
Check Digit Verification of cas no
The CAS Registry Mumber 101819-99-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,1,8,1 and 9 respectively; the second part has 2 digits, 9 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 101819-99:
(8*1)+(7*0)+(6*1)+(5*8)+(4*1)+(3*9)+(2*9)+(1*9)=112
112 % 10 = 2
So 101819-99-2 is a valid CAS Registry Number.
InChI:InChI=1/C8H9Cl2NO.ClH/c1-2-4-5(9)3-6(11)8(12)7(4)10;/h3,12H,2,11H2,1H3;1H
