101342-76-1 Usage
Description
BIS(1-BUTYLPENTYL) DECANE-1,10-DIYL DIGLUTARATE, also known as O,?O''-Decane-?1,?10-?diyl di(nonan-?5-?yl) Diglutarate, is a chemical compound with a unique structure that consists of a decane backbone connected to two nonan-5-yl chains through glutarate groups. This structure endows it with specific properties that make it suitable for various applications.
Uses
Used in Analytical Chemistry:
BIS(1-BUTYLPENTYL) DECANE-1,10-DIYL DIGLUTARATE is used as a component in analytical studies for its ability to selectively determine cations and anions. Its unique structure allows for precise detection and analysis of specific ions in complex samples, making it a valuable tool in research and quality control.
Used in Technical and Engineered Materials:
In the field of technical and engineered materials, BIS(1-BUTYLPENTYL) DECANE-1,10-DIYL DIGLUTARATE is used in the development of voltammetric ion-selective electrodes. These electrodes leverage the compound's selective ion determination properties to create highly sensitive and accurate sensors for various applications, including environmental monitoring, medical diagnostics, and industrial process control.
Check Digit Verification of cas no
The CAS Registry Mumber 101342-76-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,1,3,4 and 2 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 101342-76:
(8*1)+(7*0)+(6*1)+(5*3)+(4*4)+(3*2)+(2*7)+(1*6)=71
71 % 10 = 1
So 101342-76-1 is a valid CAS Registry Number.
InChI:InChI=1/C38H70O8/c1-5-9-23-33(24-10-6-2)45-37(41)29-21-27-35(39)43-31-19-17-15-13-14-16-18-20-32-44-36(40)28-22-30-38(42)46-34(25-11-7-3)26-12-8-4/h33-34H,5-32H2,1-4H3