1003709-80-5 Usage
Description
2,4-Difluoro-3,5-dimethoxy benzoic acid is an organic compound characterized by the presence of two fluorine atoms at the 2nd and 4th positions, and two methoxy groups at the 3rd and 5th positions on a benzoic acid backbone. This chemical structure endows it with unique properties that make it valuable in various applications.
Uses
Used in Pharmaceutical Industry:
2,4-Difluoro-3,5-dimethoxy benzoic acid is used as a key intermediate in the synthesis of Isoindoline derivatives, which are known for their anesthetic activity. The compound plays a crucial role in the development of new anesthetic agents that can potentially offer improved efficacy, safety, and reduced side effects in medical and surgical procedures.
Used in Chemical Synthesis:
In addition to its pharmaceutical applications, 2,4-Difluoro-3,5-dimethoxy benzoic acid can also be utilized in the synthesis of other organic compounds with diverse applications. Its unique structure allows for further functionalization and modification, making it a versatile building block in organic chemistry and potentially leading to the discovery of new materials and compounds with various uses across different industries.
Check Digit Verification of cas no
The CAS Registry Mumber 1003709-80-5 includes 10 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 7 digits, 1,0,0,3,7,0 and 9 respectively; the second part has 2 digits, 8 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 1003709-80:
(9*1)+(8*0)+(7*0)+(6*3)+(5*7)+(4*0)+(3*9)+(2*8)+(1*0)=105
105 % 10 = 5
So 1003709-80-5 is a valid CAS Registry Number.
InChI:InChI=1S/C9H8F2O4/c1-14-5-3-4(9(12)13)6(10)8(15-2)7(5)11/h3H,1-2H3,(H,12,13)
