Products Categories
CAS No.: | 5650-44-2 |
---|---|
Name: | 2-(methylamino)propiophenone |
Molecular Structure: | |
|
|
Formula: | C10H13NO |
Molecular Weight: | 163.219 |
Synonyms: | Propiophenone,2-(methylamino)- (6CI,7CI,8CI);1-Phenyl-1-oxo-2-methylaminopropane;1-Phenyl-2-methylamino-1-propanone;Ephedrone;Methcathinone;Monomethylpropion;UR 1431; |
EINECS: | 227-092-7 |
Density: | 1.04 g/cm3 |
Melting Point: | 182-184 °C |
Boiling Point: | 281.8 °C at 760 mmHg |
Flash Point: | 118.2 °C |
The CAS register number of 1-Propanone,2-(methylamino)-1-phenyl- is 5650-44-2. It also can be called as 1-[2-(Methylamino)phenyl]propan-1-one and the IUPAC name about this chemical is 2-(methylamino)-1-phenylpropan-1-one. The molecular formula about this chemical is C10H13NO and the molecular weight is 163.21632. This chemical is a psychoactive stimulant, sometimes used as a recreational drug and considered addictive.
Physical properties about 1-Propanone,2-(methylamino)-1-phenyl- are: (1)ACD/LogP: 2.77; (2)ACD/LogD (pH 5.5): 2.77; (3)ACD/LogD (pH 7.4): 2.77; (4)ACD/BCF (pH 5.5): 75.39; (5)ACD/BCF (pH 7.4): 75.5; (6)ACD/KOC (pH 5.5): 767.71; (7)ACD/KOC (pH 7.4): 768.88; (8)#H bond acceptors: 2; (9)#H bond donors: 1; (10)#Freely Rotating Bonds: 3; (11)Polar Surface Area: 29.1Å2; (12)Index of Refraction: 1.557; (13)Molar Refractivity: 50.52 cm3; (14)Molar Volume: 156.9 cm3; (15)Polarizability: 20.02x10-24cm3; (16)Surface Tension: 38.5 dyne/cm; (17)Enthalpy of Vaporization: 52.06 kJ/mol; (18)Boiling Point: 281.8 °C at 760 mmHg; (19)Vapour Pressure: 0.00349 mmHg at 25°C.
You can still convert the following datas into molecular structure:
(1)SMILES: CNc1ccccc1C(=O)CC
(2)InChI: InChI=1/C10H13NO/c1-3-10(12)8-6-4-5-7-9(8)11-2/h4-7,11H,3H2,1-2H3
(3)InChIKey: NGNHGKZBLXYQBG-UHFFFAOYAN
(4)Std. InChI: InChI=1S/C10H13NO/c1-3-10(12)8-6-4-5-7-9(8)11-2/h4-7,11H,3H2,1-2H3
(5)Std. InChIKey: NGNHGKZBLXYQBG-UHFFFAOYSA-N