Products Categories
CAS No.: | 537-64-4 |
---|---|
Name: | DI-P-TOLYLMERCURY |
Molecular Structure: | |
|
|
Formula: | C14H14Hg |
Molecular Weight: | 382.855 |
Synonyms: | Mercury,di-p-tolyl- (6CI,7CI,8CI);Bis(4-methylphenyl)mercury;Bis(4-tolyl)mercury;Bis(p-methylphenyl)mercury;Bis(p-tolyl)mercury;Di-p-tolylmercury;NSC 33535; |
EINECS: | 208-672-9 |
Melting Point: | 238° |
PSA: | 0.00000 |
LogP: | 2.33670 |
The Mercury,bis(4-methylphenyl)-, with CAS registry number 537-64-4, has the systematic name of bis(4-methylphenyl)mercury. Besides this, it is also called Di-p-tolylmercury. And the chemical formula of this chemical is C14H14Hg. What's more, its EINECS is 208-672-9.
Physical properties of Mercury,bis(4-methylphenyl)-: (1)#H bond acceptors: 0; (2)#H bond donors: 0; (3)#Freely Rotating Bonds: 2; (4)Polar Surface Area: 0 Å2.
Uses of Mercury,bis(4-methylphenyl)-: it can be used to produce di-p-tolylbromonium tetrafluoroborate. This reaction will need reagents BrF3, BF3.Et2O and solvents CH2Cl2, acetonitrile. The reaction temperature is -70 ℃. The yield is about 80%.
You can still convert the following datas into molecular structure:
(1)SMILES: [Hg](c1ccc(cc1)C)c2ccc(cc2)C
(2)InChI: InChI=1/2C7H7.Hg/c2*1-7-5-3-2-4-6-7;/h2*3-6H,1H3;/rC14H14Hg/c1-11-3-7-13(8-4-11)15-14-9-5-12(2)6-10-14/h3-10H,1-2H3
(3)InChIKey: DYGWZUBGVKYLJJ-YSFGEGJKAI
(4)Std. InChI: InChI=1S/2C7H7.Hg/c2*1-7-5-3-2-4-6-7;/h2*3-6H,1H3
(5)Std. InChIKey: DYGWZUBGVKYLJJ-UHFFFAOYSA-N