Products Categories
CAS No.: | 481-46-9 |
---|---|
Name: | GINKGETIN |
Article Data: | 1 |
Molecular Structure: | |
|
|
Formula: | C32H22O10 |
Molecular Weight: | 566.521 |
Synonyms: | 3''',8-Biflavone,4',5,5'',7-tetrahydroxy-4''',7''-dimethoxy- (7CI,8CI);7,4'-Dimethylamentoflavone;Amentoflavone 7'',4'''-dimethyl ether;Ginkgetin;Ginkgotin; |
Density: | 1.506 g/cm3 |
Melting Point: | 336 °C |
Boiling Point: | 863.7 °C at 760 mmHg |
Flash Point: | 287.1 °C |
PSA: | 159.80000 |
LogP: | 5.74000 |
The Ginkgetin with the CAS number 481-46-9 is also called 7,4'-Dimethylamentoflavone. The IUPAC name is 5,7-dihydroxy-8-[5-(5-hydroxy-7-methoxy-4-oxochromen-2-yl)-2-methoxyphenyl]-2-(4-hydroxyphenyl)chromen-4-one. Its molecular formula is C32H22O10.
The properties of the chemical are: (1)ACD/LogP: 4.27; (2)# of Rule of 5 Violations: 2; (3)#H bond acceptors: 10; (4)#H bond donors: 4; (5)#Freely Rotating Bonds: 9; (6)Polar Surface Area: 107.98Å2; (7)Index of Refraction: 1.714; (8)Molar Refractivity: 147.63 cm3; (9)Molar Volume: 376.1 cm3; (10)Polarizability: 58.52×10-24cm3; (11)Surface Tension: 72.1 dyne/cm; (12)Enthalpy of Vaporization: 129.8 kJ/mol; (13)Vapour Pressure: 2.28×10-31 mmHg at 25°C.
You can still convert the following datas into molecular structure:
(1)SMILES: O=C1\C=C(/Oc2cc(OC)cc(O)c12)c6cc(c5c(O)cc(O)c3c5O/C(=C\C3=O)c4ccc(O)cc4)c(OC)cc6
(2)InChI: InChI=1/C32H22O10/c1-39-18-10-20(34)30-23(37)13-27(41-28(30)11-18)16-5-8-25(40-2)19(9-16)29-21(35)12-22(36)31-24(38)14-26(42-32(29)31)15-3-6-17(33)7-4-15/h3-14,33-36H,1-2H3
(3)InChIKey: AIFCFBUSLAEIBR-UHFFFAOYAT