The Phenol,5-amino-2,4-dichloro-, hydrochloride (1:1), with the CAS registry number 197178-93-1, is also known as 5-Amino-2,4-dichloro-phenol HCl. This chemical's molecular formula is C₆H₆Cl₃NO and molecular weight is 214.48. What's more, its systematic name is 5-Amino-2,4-dichloro-phenol hydrochloride.

Physical properties of Phenol,5-amino-2,4-dichloro-, hydrochloride (1:1) are: (1)H-Bond Donor: 3; (2)H-Bond Acceptor: 2; (3)Rotatable Bond Count: 0; (4)Tautomer Count: 9; (5)Exact Mass: 212.951497; (6)MonoIsotopic Mass: 212.951497; (7)Topological Polar Surface Area: 46.2; (8)Heavy Atom Count: 11; (9)Formal Charge: 0; (10)Complexity: 122; (11)Isotope Atom Count 0; (12)Covalently-Bonded Unit Count: 2.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: C1=C(C(=CC(=C1O)Cl)Cl)N.Cl
(2)InChI: InChI=1S/C6H5Cl2NO.ClH/c7-3-1-4(8)6(10)2-5(3)9;/h1-2,10H,9H2;1H
(3)InChIKey: FTMLWEVHTJTOLS-UHFFFAOYSA-N