The L-Phenylalanine,4-sulfo-, with the CAS registry number 34023-49-9, is also known as 4-Sulfo-L-phenylalanine. It belongs to the product category of Pharmacetical. This chemical's molecular formula is C₉H₁₁NO₅S and molecular weight is 245.25. What's more, its IUPAC name is (2S)-2-amino-3-(4-sulfophenyl)propanoic acid. 

Physical properties of 1H-Indole-3-aceticacid, 5-ethoxy-2-methyl- are: (1) ACD/BCF (pH 5.5): 1; (2)ACD/BCF (pH 7.4): 1; (3)ACD/KOC (pH 5.5): 1; (4)ACD/KOC (pH 7.4): 1; (5)#H bond acceptors: 6; (6)#H bond donors: 4; (7)#Freely Rotating Bonds: 5; (8)Polar Surface Area: 126.07 Å²; (9)Index of Refraction: 1.619; (10)Molar Refractivity: 56.24 cm³; (11)Molar Volume: 160.2 cm³; (12)Polarizability: 22.29×10^-24cm³; (13)Surface Tension: 73.1 dyne/cm; (14)Density: 1.53 g/cm³.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: C1=CC(=CC=C1CC(C(=O)O)N)S(=O)(=O)O
(2)Isomeric SMILES: C1=CC(=CC=C1C[C@@H](C(=O)O)N)S(=O)(=O)O
(3)InChI: InChI=1S/C9H11NO5S/c10-8(9(11)12)5-6-1-3-7(4-2-6)16(13,14)15/h1-4,8H,5,10H2,(H,11,12)(H,13,14,15)/t8-/m0/s1
(4)InChIKey: ALQIUGWFHKQQHV-QMMMGPOBSA-N