The Ethanone,1-(4-hydroxy-2,5-dimethylphenyl)-, with the CAS registry number 26216-10-4, is also known as 2,5-Dimethyl-4-hydroxyacetophenone. This chemical's molecular formula is C₁₀H₁₂O₂ and molecular weight is 164.20108. What's more, its IUPAC name and systematic name are the same which is called 1-(4-Hydroxy-2,5-dimethylphenyl)ethanone.

Physical properties about Ethanone,1-(4-hydroxy-2,5-dimethylphenyl)-: (1)ACD/LogP: 2.34; (2)# of Rule of 5 Violations: 0; (3)#H bond acceptors: 2; (4)#H bond donors: 1; (5)#Freely Rotating Bonds: 2; (6)Polar Surface Area: 26.3 Å²; (7)Index of Refraction: 1.541; (8)Molar Refractivity: 47.81 cm³; (9)Molar Volume: 151.9 cm³; (10)Surface Tension: 40.2 dyne/cm; (11)Density: 1.08 g/cm³; (12)Flash Point: 133.4 °C; (13)Enthalpy of Vaporization: 57.84 kJ/mol; (14)Boiling Point: 315 °C at 760 mmHg; (15)Vapour Pressure: 0.000243 mmHg at 25 °C.

You can still convert the following datas into molecular structure:
(1) SMILES: O=C(c1c(cc(O)c(c1)C)C)C
(2) InChI: InChI=1/C10H12O2/c1-6-5-10(12)7(2)4-9(6)8(3)11/h4-5,12H,1-3H3
(3) InChIKey: MHQHNHNWOMRDKM-UHFFFAOYAU