The Ethanone,1-[2-(chloromethyl)-5-phenyl-3-furanyl]- has the CAS registry number 281198-93-4. This chemical's molecular formula is C₁₃H₁₁ClO₂ and molecular weight is 234.68. What's more, its systematic name is 1-[2-(chloromethyl)-5-phenylfuran-3-yl]ethanone.

Physical properties of Ethanone,1-[2-(chloromethyl)-5-phenyl-3-furanyl]- are: (1)ACD/LogP: 1.88; (2)# of Rule of 5 Violations: 0; (3)#H bond acceptors: 2; (4)#H bond donors: 0; (5)#Freely Rotating Bonds: 3; (6)Polar Surface Area: 30.21 Å²; (7)Index of Refraction: 1.553; (8)Molar Refractivity: 62.938 cm³; (9)Molar Volume: 196.738 cm³; (10)Polarizability: 24.951×10^-24cm³; (11)Surface Tension: 40.089 dyne/cm; (12)Density: 1.193 g/cm³; (13)Flash Point: 182.414 °C; (14)Enthalpy of Vaporization: 62.585 kJ/mol; (15)Boiling Point: 378.01 °C at 760 mmHg.

You can still convert the following datas into molecular structure:
(1)SMILES: ClCc2oc(c1ccccc1)cc2C(=O)C
(2)InChI: InChI=1S/C13H11ClO2/c1-9(15)11-7-12(16-13(11)8-14)10-5-3-2-4-6-10/h2-7H,8H2,1H3
(3)InChIKey: VNKATXNPMLRQQQ-UHFFFAOYSA-N