The Benzene,1,1'-oxybis[(methoxymethyl)-, with the CAS registry number 29060-60-4, is also known as 1,1'-Oxybis((methoxymethyl)benzene). Its EINECS registry number is 249-396-9. This chemical's molecular formula is C₁₆H₁₈O₃ and molecular weight is 258.31232. Its IUPAC name is called 1-(methoxymethyl)-2-[3-(methoxymethyl)phenoxy]benzene.

Physical properties of Benzene,1,1'-oxybis[(methoxymethyl)-: (1)ACD/LogP: 3.69; (2)ACD/LogD (pH 5.5): 3.69; (3)ACD/LogD (pH 7.4): 3.69; (4)ACD/BCF (pH 5.5): 373.96; (5)ACD/BCF (pH 7.4): 373.96; (6)ACD/KOC (pH 5.5): 2416.74; (7)ACD/KOC (pH 7.4): 2416.74; (8)#H bond acceptors: 3; (9)#Freely Rotating Bonds: 6; (10)Index of Refraction: 1.544; (11)Molar Refractivity: 75.28 cm³; (12)Molar Volume: 238.3 cm³; (13)Surface Tension: 37.7 dyne/cm; (14)Density: 1.083 g/cm³; (15)Flash Point: 110.6 °C; (16)Enthalpy of Vaporization: 54.95 kJ/mol; (17)Boiling Point: 329.7 °C at 760 mmHg; (18)Vapour Pressure: 0.000334 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: COCC1=CC(=CC=C1)OC2=CC=CC=C2COC
(2)InChI: InChI=1S/C16H18O3/c1-17-11-13-6-5-8-15(10-13)19-16-9-4-3-7-14(16)12-18-2/h3-10H,11-12H2,1-2H3
(3)InChIKey: HETOKTSWRZEZNZ-UHFFFAOYSA-N