The Benzene,1-(isocyanomethyl)-4-methoxy-, with the CAS registry number 1197-58-6, is also known as 4-Methoxybenzyl isocyanide. This chemical's molecular formula is C₉H₉NO and molecular weight is 147.17. What's more, its IUPAC name is 1-(isocyanomethyl)-4-methoxybenzene.

Physical properties of Benzene,1-(isocyanomethyl)-4-methoxy- are: (1)#H bond acceptors: 2; (2)#H bond donors: 0; (3)#Freely Rotating Bonds: 2; (4)Polar Surface Area: 13.59 Å².

You can still convert the following datas into molecular structure:
(1)SMILES: [C-]#[N+]Cc1ccc(OC)cc1
(2)Std. InChI: InChI=1S/C9H9NO/c1-10-7-8-3-5-9(11-2)6-4-8/h3-6H,7H2,2H3
(3)Std. InChIKey: WXZJSVUSIHPSQH-UHFFFAOYSA-N