The Benzenamine, 5-bromo-2,4-dichloro- has the CAS registry number 258344-01-3. This chemical's molecular formula is C₆H₄BrCl₂N and molecular weight is 240.91. What's more, its systematic name is 5-bromo-2,4-dichloroaniline.

Physical properties of Benzenamine, 5-bromo-2,4-dichloro- are: (1)ACD/LogP: 3.75; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 3.75; (4)ACD/LogD (pH 7.4): 3.75; (5)ACD/BCF (pH 5.5): 419.37; (6)ACD/BCF (pH 7.4): 419.38; (7)ACD/KOC (pH 5.5): 2623.34; (8)ACD/KOC (pH 7.4): 2623.41; (9)#H bond acceptors: 1; (10)#H bond donors: 2; (11)#Freely Rotating Bonds: 1; (12)Polar Surface Area: 26.02 Å²; (13)Index of Refraction: 1.648; (14)Molar Refractivity: 47.96 cm³; (15)Molar Volume: 131.7 cm³; (16)Polarizability: 19.01×10^-24cm³; (17)Surface Tension: 52.8 dyne/cm; (18)Density: 1.827 g/cm³; (19)Flash Point: 134.7 °C; (20)Enthalpy of Vaporization: 53.91 kJ/mol; (21)Boiling Point: 299.1 °C at 760 mmHg; (22)Vapour Pressure: 0.00122 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: Clc1cc(Cl)c(Br)cc1N
(2)InChI: InChI=1S/C6H4BrCl2N/c7-3-1-6(10)5(9)2-4(3)8/h1-2H,10H2
(3)InChIKey: XOVRCEWAVBWIGX-UHFFFAOYSA-N