The Benzenamine,2,3-dichloro-, hydrochloride (1:1), with the CAS registry number 23068-34-0, is also known as Aniline,2,3-dichloro-, hydrochloride (8CI). This chemical's molecular formula is C₆H₆Cl₃N and molecular weight is 198.48. What's more, its IUPAC name is 2,3-dichloroaniline hydrochloride.

Physical properties of Benzenamine,2,3-dichloro-, hydrochloride (1:1) are: (1)ACD/LogP: 2.66; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 2.66; (4)ACD/LogD (pH 7.4): 2.66; (5)ACD/BCF (pH 5.5): 62.1; (6)ACD/BCF (pH 7.4): 62.11; (7)ACD/KOC (pH 5.5): 668.51; (8)ACD/KOC (pH 7.4): 668.59; (9)#H bond acceptors: 1; (10)#H bond donors: 2; (11)#Freely Rotating Bonds: 1; (12)Polar Surface Area: 3.24 Å²; (13)Flash Point: 103.9 °C; (14)Enthalpy of Vaporization: 48.93 kJ/mol; (15)Boiling Point: 252 °C at 760 mmHg; (16)Vapour Pressure: 0.0198 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: C1=CC(=C(C(=C1)Cl)Cl)N.Cl
(2)InChI: InChI=1S/C6H5Cl2N.ClH/c7-4-2-1-3-5(9)6(4)8;/h1-3H,9H2;1H
(3)InChIKey: RAEZMDXXPWDHRQ-UHFFFAOYSA-N