The 6H-Dibenzo[b,d]pyran, with the CAS registry number 229-95-8, is also known as 6H-Dibenzo[b,d]-pyran. This chemical's molecular formula is C₁₃H₁₀O and molecular weight is 182.2179. Its IUPAC name is called 6H-benzo[c]chromene.

Physical properties of 6H-Dibenzo[b,d]pyran: (1)ACD/LogP: 3.89; (2)ACD/LogD (pH 5.5): 3.89; (3)ACD/LogD (pH 7.4): 3.89; (4)ACD/BCF (pH 5.5): 529.99; (5)ACD/BCF (pH 7.4): 529.99; (6)ACD/KOC (pH 5.5): 3101.93; (7)ACD/KOC (pH 7.4): 3101.93; (8)#H bond acceptors: 1; (9)Index of Refraction: 1.622; (10)Molar Refractivity: 55.4 cm³; (11)Molar Volume: 157.1 cm³; (12)Surface Tension: 47 dyne/cm; (13)Density: 1.159 g/cm³; (14)Flash Point: 151.8 °C; (15)Enthalpy of Vaporization: 55.34 kJ/mol; (16)Boiling Point: 333.4 °C at 760 mmHg; (17)Vapour Pressure: 0.000265 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: C1C2=CC=CC=C2C3=CC=CC=C3O1
(2)InChI: InChI=1S/C13H10O/c1-2-6-11-10(5-1)9-14-13-8-4-3-7-12(11)13/h1-8H,9H2
(3)InChIKey: BEUDCHGZCTUAOG-UHFFFAOYSA-N