The 3,6-Difluoropyridine-2-carboxylic acid, with the CAS registry number 851386-45-3, is also known as 3,6-Difluoro-2-pyridinecarboxylic acid. This chemical's molecular formula is C₆H₃F₂NO₂ and molecular weight is 159.09. What's more, its systematic name is 3,6-difluoropyridine-2-carboxylic acid.

Physical properties of 3,6-Difluoropyridine-2-carboxylic acid are: (1)ACD/LogP: 0.25; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): -2.59; (4)ACD/LogD (pH 7.4): -2.89; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 1; (7)ACD/KOC (pH 5.5): 1; (8)ACD/KOC (pH 7.4): 1; (9)#H bond acceptors: 3; (10)#H bond donors: 1; (11)#Freely Rotating Bonds: 1; (12)Polar Surface Area: 39.19 Å²; (13)Index of Refraction: 1.515; (14)Molar Refractivity: 31.26 cm³; (15)Molar Volume: 103.6 cm³; (16)Polarizability: 12.39×10^-24cm³; (17)Surface Tension: 51.6 dyne/cm; (18)Density: 1.535 g/cm³; (19)Flash Point: 121.6 °C; (20)Enthalpy of Vaporization: 54.5 kJ/mol; (21)Boiling Point: 277.4 °C at 760 mmHg; (22)Vapour Pressure: 0.00218 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: Fc1c(nc(F)cc1)C(=O)O
(2)InChI: InChI=1S/C6H3F2NO2/c7-3-1-2-4(8)9-5(3)6(10)11/h1-2H,(H,10,11)
(3)InChIKey: FSXFZWBQCAGFHG-UHFFFAOYSA-N