The 2-Furanaceticacid, alpha-[(methoxycarbonyl)oxy]-,methyl ester, with the CAS registry number 94110-10-8, is also known as Methyl alpha-((methoxycarbonyl)oxy)furan-2-acetate. Its EINECS registry number is 302-549-4. This chemical's molecular formula is C₉H₁₀O₆ and molecular weight is 214.1721. Its IUPAC name is called methyl 2-(furan-2-yl)-2-methoxycarbonyloxyacetate.

Physical properties of 2-Furanaceticacid, alpha-[(methoxycarbonyl)oxy]-,methyl ester: (1)ACD/LogP: 1.40; (2)ACD/LogD (pH 5.5): 1.4; (3)ACD/LogD (pH 7.4): 1.4; (4)#H bond acceptors: 6; (5)#Freely Rotating Bonds: 6; (6)Index of Refraction: 1.472; (7)Molar Refractivity: 47.29 cm³; (8)Molar Volume: 168.6 cm³; (9)Surface Tension: 40.3 dyne/cm; (10)Density: 1.269 g/cm³; (11)Flash Point: 105.2 °C; (12)Enthalpy of Vaporization: 48.75 kJ/mol; (13)Boiling Point: 250.3 °C at 760 mmHg; (14)Vapour Pressure: 0.0219 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: COC(=O)C(C1=CC=CO1)OC(=O)OC
(2)InChI: InChI=1S/C9H10O6/c1-12-8(10)7(15-9(11)13-2)6-4-3-5-14-6/h3-5,7H,1-2H3
(3)InChIKey: MDSSZZXFPUYYPR-UHFFFAOYSA-N