The 2,4-Imidazolidinedione,5-hexyl-5-(4-pyridinyl)- has the CAS registry number 6294-67-3. This chemical's molecular formula is C₁₄H₁₉N₃O₂ and molecular weight is 261.32. What's more, its systematic name is 5-hexyl-5-(pyridin-4-yl)imidazolidine-2,4-dione.

Physical properties of 2,4-Imidazolidinedione,5-hexyl-5-(4-pyridinyl)- are: (1)ACD/LogP: 2.16; (2)# of Rule of 5 Violations: 0; (3)#H bond acceptors: 5; (4)#H bond donors: 2; (5)#Freely Rotating Bonds: 6; (6)Polar Surface Area: 53.51 Å²; (7)Index of Refraction: 1.521; (8)Molar Refractivity: 71.09 cm³; (9)Molar Volume: 233.2 cm³; (10)Polarizability: 28.18×10^-24cm³; (11)Surface Tension: 41.9 dyne/cm; (12)Density: 1.12 g/cm³.

You can still convert the following datas into molecular structure:
(1)SMILES: O=C2NC(=O)NC2(c1ccncc1)CCCCCC
(2)InChI: InChI=1S/C14H19N3O2/c1-2-3-4-5-8-14(11-6-9-15-10-7-11)12(18)16-13(19)17-14/h6-7,9-10H,2-5,8H2,1H3,(H2,16,17,18,19)
(3)InChIKey: LGEQNNPYUPCWBN-UHFFFAOYSA-N