The 2,4-Imidazolidinedione,1-decyl- has the CAS registry number 85391-27-1. Its EINECS number is 286-781-0. This chemical's molecular formula is C₁₃H₂₄N₂O₂ and molecular weight is 240.34. What's more, its systematic name is 1-decylimidazolidine-2,4-dione.

Physical properties of 2,4-Imidazolidinedione,1-decyl- are: (1)ACD/LogP: 3.33; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 3.33; (4)ACD/LogD (pH 7.4): 3.32; (5)ACD/BCF (pH 5.5): 198.48; (6)ACD/BCF (pH 7.4): 195.99; (7)ACD/KOC (pH 5.5): 1535.63; (8)ACD/KOC (pH 7.4): 1516.43; (9)#H bond acceptors: 4; (10)#H bond donors: 1; (11)#Freely Rotating Bonds: 9; (12)Polar Surface Area: 40.62 Å²; (13)Index of Refraction: 1.477; (14)Molar Refractivity: 67.4 cm³; (15)Molar Volume: 238.4 cm³; (16)Polarizability: 26.71×10^-24cm³; (17)Surface Tension: 36.5 dyne/cm; (18)Density: 1.007 g/cm³.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: CCCCCCCCCCN1CC(=O)NC1=O
(2)InChI: InChI=1S/C13H24N2O2/c1-2-3-4-5-6-7-8-9-10-15-11-12(16)14-13(15)17/h2-11H2,1H3,(H,14,16,17)
(3)InChIKey: HRKFLPRNEULGNH-UHFFFAOYSA-N