The 2,4-Imidazolidinedione,1-amino-, with the CAS registry number 6301-02-6, is also known as 1-Amino-2,4-imidazolidinedione. Its EINECS number is 228-593-3. This chemical's molecular formula is C₃H₅N₃O₂ and molecular weight is 115.09. What's more, its IUPAC name is 1-aminoimidazolidine-2,4-dione.

Physical properties of 2,4-Imidazolidinedione,1-amino- are: (1)ACD/LogP: -1.97; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): -1.98; (4)ACD/LogD (pH 7.4): -2.34; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 1; (7)ACD/KOC (pH 5.5): 1.98; (8)ACD/KOC (pH 7.4): 1; (9)#H bond acceptors: 5; (10)#H bond donors: 3; (11)#Freely Rotating Bonds: 1; (12)Polar Surface Area: 43.86 Å²; (13)Index of Refraction: 1.556; (14)Molar Refractivity: 24.56 cm³; (15)Molar Volume: 76.3 cm³; (16)Polarizability: 9.73×10^-24cm³; (17)Surface Tension: 62.9 dyne/cm; (18)Density: 1.506 g/cm³.

Uses of 2,4-Imidazolidinedione,1-amino-: it can be used to produce 1-[5-(4-nitro-phenyl)-furan-2-ylmethyleneamino]-imidazolidine-2,4-dione. It will need solvents H₂O, dimethylformamide. The yield is about 81%.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: C1C(=O)NC(=O)N1N
(2)InChI: InChI=1S/C3H5N3O2/c4-6-1-2(7)5-3(6)8/h1,4H2,(H,5,7,8)
(3)InChIKey: KVYKDNGUEZRPGJ-UHFFFAOYSA-N