The 2,4-Furandicarboxylic acid, with the CAS registry number 4282-28-4, is also known as AC1Q72VO. This chemical's molecular formula is C₆H₄O₅ and molecular weight is 156.09296. Its IUPAC name is called furan-2,4-dicarboxylic acid.

Physical properties of 2,4-Furandicarboxylic acid: (1)ACD/LogP: 0.85; (2)ACD/LogD (pH 5.5): -3; (3)ACD/LogD (pH 7.4): -4; (4)ACD/BCF (pH 5.5): 1; (5)ACD/BCF (pH 7.4): 1; (6)ACD/KOC (pH 5.5): 1; (7)ACD/KOC (pH 7.4): 1; (8)#H bond acceptors: 5; (9)#H bond donors: 2; (10)#Freely Rotating Bonds: 2; (11)Index of Refraction: 1.581; (12)Molar Refractivity: 32.413 cm³; (13)Molar Volume: 97.287 cm³; (14)Surface Tension: 74.175 dyne/cm; (15)Density: 1.604 g/cm³; (16)Flash Point: 205.631 °C; (17)Enthalpy of Vaporization: 70.601 kJ/mol; (18)Boiling Point: 416.399 °C at 760 mmHg; (19)Vapour Pressure: 0 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: C1=C(OC=C1C(=O)O)C(=O)O
(2)InChI: InChI=1S/C6H4O5/c7-5(8)3-1-4(6(9)10)11-2-3/h1-2H,(H,7,8)(H,9,10)
(3)InChIKey: JOTDFEIYNHTJHZ-UHFFFAOYSA-N