The 2,4-Dinitro-1-[2-(3-nitrophenyl)ethenyl]benzene, with the CAS registry number 65200-02-4, is also known as 2,4-Dinitro-1-(3-nitrostyryl)benzene. This chemical's molecular formula is C₁₄H₉N₃O₆ and molecular weight is 315.23776. Its IUPAC name is called 2,4-dinitro-1-[2-(3-nitrophenyl)ethenyl]benzene.

Physical properties of 2,4-Dinitro-1-[2-(3-nitrophenyl)ethenyl]benzene: (1)ACD/LogP: 4.00; (2)#H bond acceptors: 9; (3)#Freely Rotating Bonds: 5; (4)Index of Refraction: 1.732; (5)Molar Refractivity: 83.28 cm³; (6)Molar Volume: 208.1 cm³; (7)Surface Tension: 72.9 dyne/cm; (8)Density: 1.514 g/cm³; (9)Flash Point: 227.5 °C; (10)Enthalpy of Vaporization: 70.66 kJ/mol; (11)Boiling Point: 471.8 °C at 760 mmHg; (12)Vapour Pressure: 1.28E-08 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: C1=CC(=CC(=C1)[N+](=O)[O-])C=CC2=C(C=C(C=C2)[N+](=O)[O-])[N+](=O)[O-]
(2)InChI: InChI=1S/C14H9N3O6/c18-15(19)12-3-1-2-10(8-12)4-5-11-6-7-13(16(20)21)9-14(11)17(22)23/h1-9H
(3)InChIKey: OUXDWRIVHNBVLH-UHFFFAOYSA-N