Both the product name and the systematic name of this chemical are the same which is called 2,4-Dichloro-N-isopropylbenzenesulfonamide. Its CAS registry number is 1018135-23-3. This chemical's molecular formula is C₉H₁₁Cl₂NO₂S and molecular weight is 268.16. 

Physical properties of 2,4-Dichloro-N-isopropylbenzenesulfonamide: (1)ACD/LogP: 3.16; (2)ACD/LogD (pH 5.5): 3.16; (3)ACD/LogD (pH 7.4): 3.16; (4)#H bond acceptors: 3; (5)#H bond donors: 1; (6)#Freely Rotating Bonds: 2; (7)Index of Refraction: 1.548; (8)Molar Refractivity: 62.74 cm³; (9)Molar Volume: 197.3 cm³; (10)Surface Tension: 42.5 dyne/cm; (11)Density: 1.359 g/cm³; (12)Flash Point: 173.6 °C; (13)Enthalpy of Vaporization: 60.95 kJ/mol; (14)Boiling Point: 363.4 °C at 760 mmHg; (15)Vapour Pressure: 1.81E-05 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: CC(C)NS(=O)(=O)c1ccc(cc1Cl)Cl
(2)InChI: InChI=1/C9H11Cl2NO2S/c1-6(2)12-15(13,14)9-4-3-7(10)5-8(9)11/h3-6,12H,1-2H3
(3)InChIKey: POBCOPHDUAQZEW-UHFFFAOYAF