The CAS registry number of 2,4-Dichloro-6-methoxy-3-quinolinecarboxaldehyde is 151772-24-6. This chemical's molecular formula is C₁₁H₇Cl₂NO₂ and molecular weight is 256.08478. Its systematic name is called 2,4-dichloro-6-methoxyquinoline-3-carbaldehyde.

Physical properties of 2,4-Dichloro-6-methoxy-3-quinolinecarboxaldehyde: (1)ACD/LogP: 3.63; (2)ACD/LogD (pH 5.5): 3; (3)ACD/LogD (pH 7.4): 3; (4)ACD/BCF (pH 5.5): 138; (5)ACD/BCF (pH 7.4): 138; (6)ACD/KOC (pH 5.5): 1184; (7)ACD/KOC (pH 7.4): 1184; (8)#H bond acceptors: 3; (9)#Freely Rotating Bonds: 2; (10)Index of Refraction: 1.664; (11)Molar Refractivity: 65.408 cm³; (12)Molar Volume: 176.343 cm³; (13)Surface Tension: 54.312 dyne/cm; (14)Density: 1.452 g/cm³; (15)Flash Point: 184.941 °C; (16)Enthalpy of Vaporization: 63.057 kJ/mol; (17)Boiling Point: 382.188 °C at 760 mmHg; (18)Vapour Pressure: 0 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: Clc1c2cc(OC)ccc2nc(Cl)c1C=O
(2)InChI: InChI=1/C11H7Cl2NO2/c1-16-6-2-3-9-7(4-6)10(12)8(5-15)11(13)14-9/h2-5H,1H3
(3)InChIKey: INUHYLAJVYJEND-UHFFFAOYAJ