The 2,4-Dibromopyridine-3-carboxaldehyde, with the CAS registry number 128071-91-0, is also known as 3-Pyridinecarboxaldehyde, 2,4-dibromo-. This chemical's molecular formula is C₆H₃Br₂NO and molecular weight is 264.9021. Its systematic name is called 2,4-dibromopyridine-3-carbaldehyde.

Physical properties of 2,4-Dibromopyridine-3-carboxaldehyde: (1)ACD/LogP: 1.80; (2)ACD/LogD (pH 5.5): 1.8; (3)ACD/LogD (pH 7.4): 1.8; (4)#H bond acceptors: 2; (5)#Freely Rotating Bonds: 1; (6)Index of Refraction: 1.654; (7)Molar Refractivity: 46.47 cm³; (8)Molar Volume: 126.6 cm³; (9)Surface Tension: 56.5 dyne/cm; (10)Density: 2.09 g/cm³; (11)Flash Point: 143.3 °C; (12)Enthalpy of Vaporization: 55.45 kJ/mol; (13)Boiling Point: 313.4 °C at 760 mmHg; (14)Vapour Pressure: 0.000498 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: c1cnc(c(c1Br)C=O)Br
(2)InChI: InChI=1/C6H3Br2NO/c7-5-1-2-9-6(8)4(5)3-10/h1-3H
(3)InChIKey: TXLALYLVGBOCHK-UHFFFAOYAB