The CAS registry number of 2,4-Decadienoic acid,propyl ester is 84788-08-9. Its EINECS registry number is 284-147-8. This chemical's molecular formula is C₁₃H₂₂O₂ and molecular weight is 210.3126. Its systematic name is called propyl deca-2,4-dienoate.

Physical properties of 2,4-Decadienoic acid,propyl ester: (1)ACD/LogP:5.05; (2)# of Rule of 5 Violations:1; (3)ACD/LogD (pH 5.5):5.05; (4)ACD/LogD (pH 7.4):5.05; (5)#H bond acceptors:2; (6)#Freely Rotating Bonds:9; (7)Index of Refraction:1.461; (8)Molar Refractivity:64.16 cm³; (9)Molar Volume:233.8 cm³; (10)Surface Tension:30.2 dyne/cm; (11)Density:0.899 g/cm³; (12)Flash Point:128.3 °C; (13)Enthalpy of Vaporization:52.17 kJ/mol; (14)Boiling Point:282.8 °C at 760 mmHg; (15)Vapour Pressure:0.00328 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: CCCOC(=O)C=CC=CCCCCC
(2)InChI: InChI=1/C13H22O2/c1-3-5-6-7-8-9-10-11-13(14)15-12-4-2/h8-11H,3-7,12H2,1-2H3
(3)InChIKey: RKDOXCGYGLYOBV-UHFFFAOYAD