The 2,4,6(1H,3H,5H)-Pyrimidinetrione,5-butyl-, with the CAS registry number 1953-33-9, is also known as Barbituric acid, 5-butyl-. Its EINECS registry number is 217-781-0. This chemical's molecular formula is C₈H₁₂N₂O₃ and molecular weight is 184.1925. Its IUPAC name is called 5-butyl-1,3-diazinane-2,4,6-trione.

Physical properties of 2,4,6(1H,3H,5H)-Pyrimidinetrione,5-butyl-: (1)ACD/LogP: 0.63; (2)ACD/LogD (pH 5.5): 0.57; (3)ACD/LogD (pH 7.4): -0.49; (4)ACD/BCF (pH 5.5): 1.53; (5)ACD/BCF (pH 7.4): 1; (6)ACD/KOC (pH 5.5): 45.31; (7)ACD/KOC (pH 7.4): 3.98; (8)#H bond acceptors: 5; (9)#H bond donors: 2; (10)#Freely Rotating Bonds: 3; (11)Index of Refraction: 1.468; (12)Molar Refractivity: 44.12 cm³; (13)Molar Volume: 158.5 cm³; (14)Surface Tension: 36.8 dyne/cm; (15)Density: 1.161 g/cm³.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: CCCCC1C(=O)NC(=O)NC1=O
(2)InChI: InChI=1S/C8H12N2O3/c1-2-3-4-5-6(11)9-8(13)10-7(5)12/h5H,2-4H2,1H3,(H2,9,10,11,12,13)
(3)InChIKey: HTKIZIQFMHVTRJ-UHFFFAOYSA-N