The 2,4,5-Triamino-6-pyrimidinol dihydrochloride, with the CAS registry number 51324-37-9, is also known as 2,5,6-Triaminopyrimidin-4-ol dihydrochloride. This chemical's molecular formula is C₄H₉Cl₂N₅O and molecular weight is 214.05. Its systematic name is called 2,5,6-triaminopyrimidin-4(1H)-one dihydrochloride.

Physical properties of 2,4,5-Triamino-6-pyrimidinol dihydrochloride: (1)ACD/LogP: -3.08; (2)# of Rule of 5 Violations: 1; (3)ACD/LogD (pH 5.5): -3.11; (4)ACD/LogD (pH 7.4): -3.08; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 1; (7)ACD/KOC (pH 5.5): 1; (8)ACD/KOC (pH 7.4): 1; (9)#H bond acceptors: 6; (10)#H bond donors: 7; (11)#Freely Rotating Bonds: 2; (12)Flash Point: 121.3 °C; (13)Enthalpy of Vaporization: 51.55 kJ/mol; (14)Boiling Point: 277 °C at 760 mmHg; (15)Vapour Pressure: 0.00465 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: O=C1/N=C(\NC(\N)=C1\N)N.Cl.Cl
(2)InChI: InChI=1/C4H7N5O.2ClH/c5-1-2(6)8-4(7)9-3(1)10;;/h5H2,(H5,6,7,8,9,10);2*1H
(3)InChIKey: RGALMPOBPCWQJV-UHFFFAOYAI