The 2,4(1H,3H)-Pyrimidinedione,6-methoxy-, with the CAS registry number 29458-38-6, is also known as 2,4-Dihydroxy-5-methoxypyrimidine. It belongs to the product categories of Pyrimidine; Pyridines, Pyrimidines, Purines and Pteredines. This chemical's molecular formula is C₅H₆N₂O₃ and molecular weight is 142.11. Its systematic name is called 6-methoxypyrimidine-2,4(1H,3H)-dione.

Physical properties of 2,4(1H,3H)-Pyrimidinedione,6-methoxy-: (1)ACD/LogP: -0.70; (2)ACD/BCF (pH 5.5): 1; (3)ACD/BCF (pH 7.4): 1; (4)ACD/KOC (pH 5.5): 9.91; (5)ACD/KOC (pH 7.4): 7.92; (6)#H bond acceptors: 5; (7)#H bond donors: 2; (8)#Freely Rotating Bonds: 1; (9)Index of Refraction: 1.54; (10)Molar Refractivity: 32.1 cm³; (11)Molar Volume: 102.2 cm³; (12)Surface Tension: 49.8 dyne/cm; (13)Density: 1.39 g/cm³.

You can still convert the following datas into molecular structure:
(1)SMILES: O=C1NC(/OC)=C\C(=O)N1
(2)InChI: InChI=1/C5H6N2O3/c1-10-4-2-3(8)6-5(9)7-4/h2H,1H3,(H2,6,7,8,9)
(3)InChIKey: SWNDNOHEVRPIDI-UHFFFAOYAH