The 2,4(1H,3H)-Pyrimidinedione,5-(2-propen-1-yl)-, with the CAS registry number 59090-35-6, is also known as NSC81160. This chemical's molecular formula is C₇H₈N₂O₂ and molecular weight is 152.15062. Its IUPAC name is called 5-prop-2-enyl-1H-pyrimidine-2,4-dione.

Physical properties of 2,4(1H,3H)-Pyrimidinedione,5-(2-propen-1-yl)-: (1)ACD/LogP: 0.67; (2)ACD/LogD (pH 5.5): 0.67; (3)ACD/LogD (pH 7.4): 0.66; (4)ACD/BCF (pH 5.5): 1.91; (5)ACD/BCF (pH 7.4): 1.87; (6)ACD/KOC (pH 5.5): 55.37; (7)ACD/KOC (pH 7.4): 54.16; (8)#H bond acceptors: 4; (9)#H bond donors: 2; (10)#Freely Rotating Bonds: 2; (11)Index of Refraction: 1.498; (12)Molar Refractivity: 38.68 cm³; (13)Molar Volume: 131.9 cm³; (14)Surface Tension: 34.8 dyne/cm; (15)Density: 1.152 g/cm³.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: C=CCC1=CNC(=O)NC1=O
(2)InChI: InChI=1S/C7H8N2O2/c1-2-3-5-4-8-7(11)9-6(5)10/h2,4H,1,3H2,(H2,8,9,10,11)
(3)InChIKey: VOBFOFTXJVSVTJ-UHFFFAOYSA-N