96557-36-7 Usage
Benzene derivative
A compound based on the benzene structure, which is a six-membered aromatic ring with alternating single and double bonds.
Bromine atom
A halogen atom (bromine) attached to the benzene ring, which imparts specific reactivity and properties to the molecule.
Dioxolane ring
A five-membered ring containing two oxygen atoms, which serves as a substituent in the compound.
Substituent
The dioxolane ring and bromine atom are attached to the benzene ring, altering its chemical properties and reactivity.
Organic synthesis
The process of constructing complex organic molecules from simpler precursors, using 1-Bromo-2-(1,3-dioxolan-2-ylmethyl)benzene as a building block.
Pharmaceutical applications
The compound can be used in the synthesis of various pharmaceuticals due to its versatile chemical structure.
Agrochemical applications
It can also be used in the production of agrochemicals, such as pesticides and fertilizers, to improve crop yield and protect plants from pests.
Fine chemicals
The compound can be utilized in the production of specialty chemicals with specific applications in various industries.
Nucleophilic substitution
A chemical reaction in which a nucleophile (an electron-rich species) replaces a leaving group (such as a bromine atom) in a molecule.
Palladium-catalyzed cross-coupling
A type of chemical reaction that involves the formation of a new carbon-carbon bond using a palladium catalyst, allowing for the synthesis of complex organic molecules.
Metal-catalyzed asymmetric reactions
A class of chemical reactions that involve the use of metal catalysts to create chiral molecules with a specific three-dimensional arrangement of atoms, which is important in the synthesis of chiral drugs.
Medicinal chemistry applications
The compound's unique structure and reactivity make it a valuable candidate for the development of new drugs and therapeutic agents.
Materials science applications
The compound's structural features may be exploited in the design and synthesis of new materials with specific properties for various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 96557-36-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,6,5,5 and 7 respectively; the second part has 2 digits, 3 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 96557-36:
(7*9)+(6*6)+(5*5)+(4*5)+(3*7)+(2*3)+(1*6)=177
177 % 10 = 7
So 96557-36-7 is a valid CAS Registry Number.
InChI:InChI=1/C10H11BrO2/c11-9-4-2-1-3-8(9)7-10-12-5-6-13-10/h1-4,10H,5-7H2
96557-36-7Relevant articles and documents
Br?nsted acid-catalyzed tandem cycloaromatization of naphthalene-based bisacetals: Selective synthesis of ortho-fused six-hexagon benzenoids
Takahashi, Ikko,Hayashi, Masaki,Fujita, Takeshi,Ichikawa, Junji
, p. 392 - 394 (2017)
Naphthalenes bearing two acetal moieties connected by a methylene-2,1-phenylene group underwent regioselective tandem cycloaromatization using a catalytic amount of trifluoro-methanesulfonic acid in 1,1,1,3,3,3-hexafluoropropan-2-ol. Five substrates were
A new method for the preparation of 3-alkoxy- and 3-hydroxy-3,4-dihydro-1H-2-benzopyrans
Wunsch
, p. 493 - 499 (2007/10/02)
-
Iminium Ion Mediated Cyclizations of 4-Aryl-1,4-dihydropyridines. Bridging with Acetals, Carbonyls, and Thiocarbonyls
Hartman, George D.,Phillips, Brian T.,Halczenko, Wasyl
, p. 2423 - 2427 (2007/10/02)
The preparation of new aldehyde and acetal derivatives of 4-aryl-1,4-dihydropyridines has been carried out.Treatment of these compounds under acid conditions affords novel caged molecules derived from sequential intramolecular addition reactions.This proc
