88509-91-5 Usage
General Description
Dichotomitin is a chemical compound found in the Dichrocephala integrifolia plant. It is a natural product with potential pharmaceutical applications due to its reported anti-inflammatory, anti-parasitic, and anticancer properties. Studies have shown that dichotomitin has the ability to inhibit the activity of certain enzymes involved in the inflammatory process, suggesting its potential as a treatment for inflammatory conditions. Additionally, it has demonstrated activity against the parasites responsible for diseases such as Chagas disease and leishmaniasis, making it a promising candidate for the development of new anti-parasitic drugs. Furthermore, research has indicated that dichotomitin may also have potential as an anticancer agent due to its ability to induce cell death in cancer cells. Overall, the unique properties of dichotomitin make it a compound of interest for further study and potential therapeutic development.
Check Digit Verification of cas no
The CAS Registry Mumber 88509-91-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,8,5,0 and 9 respectively; the second part has 2 digits, 9 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 88509-91:
(7*8)+(6*8)+(5*5)+(4*0)+(3*9)+(2*9)+(1*1)=175
175 % 10 = 5
So 88509-91-5 is a valid CAS Registry Number.
InChI:InChI=1/C18H14O8/c1-22-12-4-8(3-10(19)17(12)23-2)9-6-24-11-5-13-18(26-7-25-13)16(21)14(11)15(9)20/h3-6,19,21H,7H2,1-2H3