87585-32-8 Usage
General Description
(+)-Lyoniresinol 9'-O-glucoside is a chemical compound typically isolated from plants, especially from the Eucommia genus which is known for its medicinal properties. As a type of lignan glycoside, it's known for its potential benefits to human health and potential biological activities, including antioxidant, anti-inflammatory, and anti-cancer properties. Its chemical structure consists of a glucose molecule linked to a lyoniresinol molecule, and it can be extracted using a variety of chemical methods. However, it is still under scientific study to fully understand its health effects and potential pharmaceutical uses.
Check Digit Verification of cas no
The CAS Registry Mumber 87585-32-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,7,5,8 and 5 respectively; the second part has 2 digits, 3 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 87585-32:
(7*8)+(6*7)+(5*5)+(4*8)+(3*5)+(2*3)+(1*2)=178
178 % 10 = 8
So 87585-32-8 is a valid CAS Registry Number.
InChI:InChI=1/C28H38O13/c1-36-15-8-13(9-16(37-2)22(15)31)19-20-12(7-17(38-3)24(33)26(20)39-4)6-14(10-29)21(19)28(40-5)27(35)25(34)23(32)18(11-30)41-28/h7-9,14,18-19,21,23,25,27,29-35H,6,10-11H2,1-5H3/t14-,18+,19-,21?,23+,25-,27+,28+/m0/s1