815-85-0 Usage
Description
Stannous Tartrate, also known as potassium hydrogen bis(2-hydroxypropane-1,2-diyldinitril)stannate, is a chemical compound with the formula C6H7O6Sn.K. It is a heavy, white, crystalline powder that is soluble in water and dilute hydrochloric acid.
Uses
Used in Dyeing and Printing Textiles:
Stannous Tartrate is used as a reducing agent in the dyeing and printing of textiles. It helps to reduce the dye molecules, making them more soluble and easier to apply to the fabric. This allows for more vibrant and long-lasting colors in the finished product.
Used in Chemical Industry:
In the chemical industry, Stannous Tartrate is used as a reducing agent in various chemical reactions. Its ability to donate electrons makes it useful in processes such as the reduction of metal ions, the synthesis of organic compounds, and the production of other chemicals.
Used in Analytical Chemistry:
Stannous Tartrate is also used in analytical chemistry as a titrant in redox titrations. It can be used to determine the concentration of oxidizing agents in a sample by reacting with them in a controlled manner and measuring the resulting change in the solution.
Overall, Stannous Tartrate is a versatile chemical compound with a range of applications in various industries, including textile dyeing and printing, chemical production, and analytical chemistry. Its reducing properties make it a valuable tool in these fields, allowing for the efficient and effective completion of various processes.
Check Digit Verification of cas no
The CAS Registry Mumber 815-85-0 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 8,1 and 5 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 815-85:
(5*8)+(4*1)+(3*5)+(2*8)+(1*5)=80
80 % 10 = 0
So 815-85-0 is a valid CAS Registry Number.
InChI:InChI=1/C4H6O6.Sn/c5-1(3(7)8)2(6)4(9)10;/h1-2,5-6H,(H,7,8)(H,9,10);/q;+2/p-2