80879-63-6 Usage
General Description
1,5-dideoxy-1,5-[[2-[4-(ethoxycarbonyl)phenoxy]ethyl]imino]-D-glucitol is a synthetic chemical compound that is used as an inhibitor of certain enzymes involved in the biosynthesis of lipopolysaccharides, which are components of the outer membrane of bacteria. 1,5-dideoxy-1,5-[[2-[4-(ethoxycarbonyl)phenoxy]ethyl]imino]-D-glucitol has been studied for its potential as an antibiotic and has shown promising activity against Gram-negative bacteria, which are known for their resistance to many existing antibiotics. Its inhibitory properties make it a potential candidate for the development of new antibiotics to combat antibiotic-resistant bacterial infections. Additionally, this compound has also been investigated for its potential use in treating certain types of cancer. However, further research is needed to fully understand its mechanisms of action and potential applications in the medical field.
Check Digit Verification of cas no
The CAS Registry Mumber 80879-63-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,0,8,7 and 9 respectively; the second part has 2 digits, 6 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 80879-63:
(7*8)+(6*0)+(5*8)+(4*7)+(3*9)+(2*6)+(1*3)=166
166 % 10 = 6
So 80879-63-6 is a valid CAS Registry Number.
InChI:InChI=1/C17H25NO7/c1-2-24-17(23)11-3-5-12(6-4-11)25-8-7-18-9-14(20)16(22)15(21)13(18)10-19/h3-6,13-16,19-22H,2,7-10H2,1H3/t13-,14+,15-,16-/m1/s1