77996-04-4 Usage
General Description
Mulberrofuran C is a chemical compound found in the root bark of the mulberry tree. It belongs to a class of compounds known as flavonoids, which are known for their antioxidant and anti-inflammatory properties. Mulberrofuran C has been studied for its potential as a therapeutic agent for cancer, diabetes, and other medical conditions. It has also shown promise in promoting hair growth and preventing hair loss. Additionally, mulberrofuran C has been found to have neuroprotective effects, making it a potential candidate for the treatment of neurodegenerative diseases such as Alzheimer's and Parkinson's. Overall, mulberrofuran C has garnered attention for its diverse medicinal properties and is being investigated for its potential in various medical applications.
Check Digit Verification of cas no
The CAS Registry Mumber 77996-04-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,7,9,9 and 6 respectively; the second part has 2 digits, 0 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 77996-04:
(7*7)+(6*7)+(5*9)+(4*9)+(3*6)+(2*0)+(1*4)=194
194 % 10 = 4
So 77996-04-4 is a valid CAS Registry Number.
InChI:InChI=1/C34H28O9/c1-16-8-24(22-6-4-19(35)13-26(22)38)32(34(42)23-7-5-20(36)14-27(23)39)25(9-16)33-28(40)10-18(11-29(33)41)30-12-17-2-3-21(37)15-31(17)43-30/h2-7,9-15,24-25,32,35-41H,8H2,1H3/t24-,25+,32-/m0/s1