6949-83-3 Usage
Description
(Z)-3-[[(4-chlorophenyl)amino]carbamoyl]prop-2-enoic acid, also known as CPAC, is a chemical compound with the molecular formula C11H10ClN3O3. It is an amino acid derivative featuring a carbamoyl group attached to the amino group of a 4-chlorophenyl ring. CPAC is recognized for its potential applications in pharmaceutical research and development, particularly in the study of anti-cancer and anti-inflammatory properties. Its unique chemical structure and properties also make it a valuable compound for various scientific and industrial applications.
Uses
Used in Pharmaceutical Research and Development:
CPAC is used as a research compound for investigating its potential anti-cancer and anti-inflammatory properties. Its chemical structure allows for the exploration of novel drug candidates that could target specific biological pathways involved in cancer and inflammation.
Used in Drug Development:
CPAC serves as a starting point for the development of new drugs to treat various diseases and conditions. Its unique structure can be modified to create derivatives with improved pharmacological properties, potentially leading to more effective treatments.
Used in Industrial Applications:
CPAC has potential uses in the production of new materials and chemicals, thanks to its distinctive chemical properties. It can be utilized in the synthesis of advanced materials for various industries, such as electronics, coatings, and polymers.
Used in Chemical Synthesis:
As a chemical compound with a reactive functional group, CPAC can be employed in chemical synthesis to create a range of new molecules with diverse applications in different fields, including pharmaceuticals, materials science, and specialty chemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 6949-83-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,9,4 and 9 respectively; the second part has 2 digits, 8 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 6949-83:
(6*6)+(5*9)+(4*4)+(3*9)+(2*8)+(1*3)=143
143 % 10 = 3
So 6949-83-3 is a valid CAS Registry Number.
InChI:InChI=1/C10H9ClN2O3/c11-7-1-3-8(4-2-7)12-13-9(14)5-6-10(15)16/h1-6,12H,(H,13,14)(H,15,16)/b6-5-
