67492-50-6 Usage
Description
3,5-Dichlorophenylboronic acid is an organic compound that serves as a versatile building block in organic synthesis, particularly in the formation of various pharmaceutical compounds and other organic molecules. It is characterized by the presence of two chlorine atoms at the 3 and 5 positions on a phenyl ring, with a boronic acid group attached to the ring. This unique structure allows it to participate in a range of chemical reactions, making it a valuable reagent in the synthesis of various compounds.
Uses
Used in Pharmaceutical Synthesis:
3,5-Dichlorophenylboronic acid is used as an intermediate in the synthesis of various pharmaceutical compounds, including inhibitors. Its unique structure allows it to be incorporated into complex organic molecules, making it a valuable component in the development of new drugs.
Used in the Suzuki-Miyaura Cross-Coupling Reaction:
3,5-Dichlorophenylboronic acid is used as a reactant in the Suzuki-Miyaura cross-coupling reaction, a widely used method for the formation of carbon-carbon bonds in organic synthesis. This reaction allows for the efficient and selective formation of biaryl compounds, which are important structural motifs in many pharmaceuticals and natural products.
Used in Trifluoromethylation:
3,5-Dichlorophenylboronic acid is used as a reactant in trifluoromethylation reactions, which involve the introduction of a trifluoromethyl group (CF3) into organic molecules. This modification can significantly alter the properties of a compound, making it a valuable tool in the synthesis of new pharmaceuticals and other organic molecules.
Used in Intramolecular Aromatic Carbenoid Insertion:
3,5-Dichlorophenylboronic acid is used as a reactant in intramolecular aromatic carbenoid insertion reactions, which involve the insertion of a carbenoid group into an aromatic ring. This reaction can lead to the formation of complex molecular structures, making it a useful method for the synthesis of novel organic compounds.
Used in Cyanation for the Synthesis of Aromatic Nitriles:
3,5-Dichlorophenylboronic acid is used as a reactant in cyanation reactions, which involve the introduction of a nitrile group (CN) into an aromatic ring. This modification can provide access to a range of aromatic nitriles, which are important intermediates in the synthesis of various organic compounds.
Used in Lithiation of Dihalophenyl Dioxazaborocines:
3,5-Dichlorophenylboronic acid is used as a reactant in the lithiation of dihalophenyl dioxazaborocines, a reaction that involves the formation of a lithium-carbon bond at the ortho position relative to the boronic acid group. This reaction can be used to introduce new functional groups at the ortho position, providing a route to the synthesis of functionalized dihalophenyl boronic acids.
Used in the Synthesis of 3,5-Dichlorobenzeneboronic Acid:
3,5-Dichlorophenylboronic acid is used as a reactant in the synthesis of 3,5-dichlorobenzeneboronic acid, an intermediate for the synthesis of various pharmaceutical compounds. Additionally, 3,5-dichlorobenzeneboronic acid has been found to facilitate the transport of various ribonucleosides in and out of liposomes, which are artificial cells used in drug delivery and other applications.
Check Digit Verification of cas no
The CAS Registry Mumber 67492-50-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,7,4,9 and 2 respectively; the second part has 2 digits, 5 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 67492-50:
(7*6)+(6*7)+(5*4)+(4*9)+(3*2)+(2*5)+(1*0)=156
156 % 10 = 6
So 67492-50-6 is a valid CAS Registry Number.
InChI:InChI=1/C6H5BCl2O2/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3,10-11H
67492-50-6Relevant articles and documents
INHIBITORS OF METALLO-BETA-LACTAMASES PRODUCED BY MULTIDRUG-RESISTANT BACTERIA
-
Paragraph 0053; 0055, (2021/05/29)
A compound having Formula I or its derivative may inhibit metallo-beta-lactamases. An investigation studying the effects of the compounds was provided by the invention of the activities of all subclasses (B1, B2, and B3) metallo-beta-lactamases. The compounds can be used for a pharmaceutical product with the ability to restore an anti-bacterial activity of a beta-lactam antibiotic, thereby treating and preventing a bacterial infection in an animal or human subject.
One-pot synthesis of arylboronic acids and aryl trifluoroborates by Ir-catalyzed borylation of arenes
Murphy, Jaclyn M.,Tzschucke, C. Christoph,Hartwig, John F.
, p. 757 - 760 (2007/10/03)
(Chemical Equation Presented) The synthesis of arylboronic acids and aryl trifluoroborates in a one-pot sequence by Ir-calalyzed borylation of arenes is reported. To prepare the arylboronic acids, the Ir-catalyzed borylation is followed by oxidative cleavage of the boronic ester with NaIO4. To prepare the aryltrifluoroborate, the Ir-catalyzed borylation is followed by displacement of pinacol by KHF2. These two-step sequences give products that are more reactive toward subsequent chemistry than the initially formed pinacol boronates.
