652-40-4 Usage
Description
3,6-DIFLUOROPHTHALIC ANHYDRIDE is an organic compound characterized by the presence of two fluorine atoms at the 3rd and 6th positions of the phthalic anhydride structure. It is a white to off-white powder with unique chemical properties that make it suitable for various applications in different industries.
Uses
Used in Pharmaceutical Industry:
3,6-DIFLUOROPHTHALIC ANHYDRIDE is used as a key intermediate in the synthesis of various pharmaceutical compounds. Its unique structure and properties allow for the development of new drugs with improved efficacy and reduced side effects.
Used in Chemical Synthesis:
3,6-DIFLUOROPHTHALIC ANHYDRIDE is used as a building block in the synthesis of a wide range of chemical compounds, including phthalic compounds, phthalazines, and quinones. These synthesized compounds exhibit antimicrobial activity, making them valuable in the development of new antimicrobial agents.
Used in Material Science:
Due to its unique chemical properties, 3,6-DIFLUOROPHTHALIC ANHYDRIDE can be used in the development of new materials with specific characteristics, such as improved thermal stability, chemical resistance, or mechanical strength. These materials can find applications in various industries, including electronics, automotive, and aerospace.
Used in Research and Development:
3,6-DIFLUOROPHTHALIC ANHYDRIDE serves as an important research compound for scientists and researchers working on the development of new drugs, materials, and chemical processes. Its unique structure and properties make it a valuable tool in the exploration of new chemical reactions and the synthesis of novel compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 652-40-4 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 6,5 and 2 respectively; the second part has 2 digits, 4 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 652-40:
(5*6)+(4*5)+(3*2)+(2*4)+(1*0)=64
64 % 10 = 4
So 652-40-4 is a valid CAS Registry Number.
InChI:InChI=1/C8H2F2O3/c9-3-1-2-4(10)6-5(3)7(11)13-8(6)12/h1-2H
