642995-16-2 Usage
General Description
The chemical compound "(1S,2S)-2-(naphthalene-2,3-dicarboximido)cyclohexanecarboxylic acid" is a complex organic molecule with a naphthalene core and a cyclohexanecarboxylic acid side chain. Its chemical structure includes two chiral centers, with both carbons having an S configuration. The molecule's aromatic naphthalene group gives it a strong fluorescence, making it potentially useful in various applications such as fluorescence imaging and sensing. Additionally, the presence of the carboxylic acid group makes it a potential candidate for incorporation into drug molecules or other biologically active compounds. However, the exact uses and potential applications of this compound may vary depending on its specific properties and characteristics.
Check Digit Verification of cas no
The CAS Registry Mumber 642995-16-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,4,2,9,9 and 5 respectively; the second part has 2 digits, 1 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 642995-16:
(8*6)+(7*4)+(6*2)+(5*9)+(4*9)+(3*5)+(2*1)+(1*6)=192
192 % 10 = 2
So 642995-16-2 is a valid CAS Registry Number.
InChI:InChI=1/C19H17NO4/c21-17-14-9-11-5-1-2-6-12(11)10-15(14)18(22)20(17)16-8-4-3-7-13(16)19(23)24/h1-2,5-6,9-10,13,16H,3-4,7-8H2,(H,23,24)/t13-,16-/m0/s1