6329-19-7 Usage
Description
(5E)-5-[(E)-3-(2-nitrophenyl)prop-2-enylidene]-2-sulfanylidene-thiazol idin-4-one is a thiazolidinone derivative with a unique structure, featuring a thiazolidin-4-one core and a substituted nitrophenyl and propenylidene group. This chemical compound has potential pharmacological properties and may be of interest for medicinal chemistry research. Its molecular structure suggests it may have biological activity, although further studies are needed to elucidate its specific effects and potential applications. Overall, (5E)-5-[(E)-3-(2-nitrophenyl)prop-2-enylidene]-2-sulfanylidene-thiazol idin-4-one presents an intriguing chemical structure with potential pharmacological implications.
Uses
Since the provided materials do not specify any particular applications for (5E)-5-[(E)-3-(2-nitrophenyl)prop-2-enylidene]-2-sulfanylidene-thiazol idin-4-one, we can only infer potential uses based on its classification as a thiazolidinone derivative with potential pharmacological properties. Here are some hypothetical applications:
Used in Pharmaceutical Industry:
(5E)-5-[(E)-3-(2-nitrophenyl)prop-2-enylidene]-2-sulfanylidene-thiazol idin-4-one could be used as a lead compound for the development of new drugs, given its potential pharmacological properties and unique molecular structure.
Used in Medicinal Chemistry Research:
(5E)-5-[(E)-3-(2-nitrophenyl)prop-2-enylidene]-2-sulfanylidene-thiazol idin-4-one may serve as a research tool for studying the interactions between its molecular structure and various biological targets, potentially leading to the discovery of new therapeutic agents.
Used in Drug Design and Development:
The unique structure of (5E)-5-[(E)-3-(2-nitrophenyl)prop-2-enylidene]-2-sulfanylidene-thiazol idin-4-one could be utilized in the design of novel drugs targeting specific diseases or conditions, pending further research into its biological activity and efficacy.
Check Digit Verification of cas no
The CAS Registry Mumber 6329-19-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,3,2 and 9 respectively; the second part has 2 digits, 1 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 6329-19:
(6*6)+(5*3)+(4*2)+(3*9)+(2*1)+(1*9)=97
97 % 10 = 7
So 6329-19-7 is a valid CAS Registry Number.
InChI:InChI=1/C12H8N2O3S2/c15-11-10(19-12(18)13-11)7-3-5-8-4-1-2-6-9(8)14(16)17/h1-7H,(H,13,15,18)/b5-3+,10-7+
